ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-88-8 izotiocyjanian 2,3,4,5-tetrachlorofenylu |
|
| Nazwa produktu: | izotiocyjanian 2,3,4,5-tetrachlorofenylu |
| Synonimy | 1,2,3,4-tetrachloro-5-izotiocyjanobenzen; |
| Angielska nazwa | 2,3,4,5-Tetrachlorophenyl isothiocyanate;1,2,3,4-tetrachloro-5-isothiocyanatobenzene |
| MF | C7HCl4NS |
| Masie cząsteczkowej | 272.9665 |
| InChI | InChI=1/C7HCl4NS/c8-3-1-4(12-2-13)6(10)7(11)5(3)9/h1H |
| Nr CAS | 206761-88-8 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.63g/cm3 |
| Temperatura wrzenia | 373.5°C at 760 mmHg |
| Współczynnik załamania | 1.649 |
| Temperatura zapłonu | 179.7°C |
| Ciśnienie pary | 1.92E-05mmHg at 25°C |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |