ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-88-8 2،3،4،5-رباعي كلورو فينيل أيزوثيوسيانات؛ 1،2،3،4-رباعي كلورو - 5-إيزوثيوسياناتوبنزين؛ |
|
| اسم المنتج | 2،3،4،5-رباعي كلورو فينيل أيزوثيوسيانات؛ 1،2،3،4-رباعي كلورو - 5-إيزوثيوسياناتوبنزين؛ |
| الاسم بالانجليزية | 2,3,4,5-Tetrachlorophenyl isothiocyanate;1,2,3,4-tetrachloro-5-isothiocyanatobenzene |
| الصيغة الجزيئية | C7HCl4NS |
| الوزن الجزيئي الغرامي | 272.9665 |
| InChI | InChI=1/C7HCl4NS/c8-3-1-4(12-2-13)6(10)7(11)5(3)9/h1H |
| إستراتيجية المساعدة القطرية | 206761-88-8 |
| بنية جزيئية | ![]() |
| كثافة | 1.63g/cm3 |
| نقطة الغليان | 373.5°C at 760 mmHg |
| معامل الإنكسار | 1.649 |
| نقطة الوميض | 179.7°C |
| ضغط البخار | 1.92E-05mmHg at 25°C |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |