ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207974-17-2 2,6-Difluorophenyl isothiocyanate |
|
| název výrobku | 2,6-Difluorophenyl isothiocyanate |
| Anglický název | 2,6-Difluorophenyl isothiocyanate;1,3-difluoro-2-isocyanatobenzene |
| Molekulární vzorec | C7H3F2NO |
| Molekulová hmotnost | 155.1016 |
| InChl | InChI=1/C7H3F2NO/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| Registrační číslo CAS | 207974-17-2 |
| Molekulární struktura | ![]() |
| Hustota | 1.24g/cm3 |
| Bod varu | 174.4°C at 760 mmHg |
| Index lomu | 1.488 |
| Bod vzplanutí | 51.5°C |
| Tlak par | 1.21mmHg at 25°C |
| Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |