ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207974-17-2 2,6-Difluorophenyl isothiocyanate |
|
שם המוצר | 2,6-Difluorophenyl isothiocyanate |
שם אנגלי | 2,6-Difluorophenyl isothiocyanate;1,3-difluoro-2-isocyanatobenzene |
מולקולרית פורמולה | C7H3F2NO |
משקל מולקולרי | 155.1016 |
InChl | InChI=1/C7H3F2NO/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
מספר CAS | 207974-17-2 |
מבנה מולקולרי | ![]() |
צפיפות | 1.24g/cm3 |
נקודת רתיחה | 174.4°C at 760 mmHg |
משקל סגולי | 1.488 |
נקודת הבזק | 51.5°C |
לחץ אדים | 1.21mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |