Chemindex > 207974-17-2
KR ▼
207974-17-2 2,6-Difluorophenyl isothiocyanate |
|
| 상품명칭 | 2,6-Difluorophenyl isothiocyanate |
| 영문 이름 | 2,6-Difluorophenyl isothiocyanate;1,3-difluoro-2-isocyanatobenzene |
| 분자식 | C7H3F2NO |
| 분자량 | 155.1016 |
| InChI | InChI=1/C7H3F2NO/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| cas번호 | 207974-17-2 |
| 분자 구조 |  |
| 밀도 | 1.24g/cm3 |
| 비등점 | 174.4°C at 760 mmHg |
| 굴절 지수 | 1.488 |
| 인화점 | 51.5°C |
| 증기압 | 1.21mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
207974-17-2 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 