Chemindex >207974-17-2
MY ▼
207974-17-2 2,6-Difluorophenyl isothiocyanate |
|
| Nama produk | 2,6-Difluorophenyl isothiocyanate |
| Nama Inggeris | 2,6-Difluorophenyl isothiocyanate;1,3-difluoro-2-isocyanatobenzene |
| MF | C7H3F2NO |
| Berat Molekul | 155.1016 |
| InChI | InChI=1/C7H3F2NO/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| CAS NO | 207974-17-2 |
| Struktur Molekul |  |
| Kepadatan | 1.24g/cm3 |
| Titik didih | 174.4°C at 760 mmHg |
| Indeks bias | 1.488 |
| Titik nyala | 51.5°C |
| Tekanan wap | 1.21mmHg at 25°C |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 207974-17-2 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 