ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207919-09-3 2,3,4-trifluorobenzamide |
|
Produkt-Name | 2,3,4-trifluorobenzamide |
Englischer Name | 2,3,4-trifluorobenzamide;Trifluorobenzamide1 |
Molekulare Formel | C7H4F3NO |
Molecular Weight | 175.108 |
InChl | InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
CAS Registry Number | 207919-09-3 |
Molecular Structure | ![]() |
Dichte | 1.45g/cm3 |
Schmelzpunkt | 127-129℃ |
Siedepunkt | 166°C at 760 mmHg |
Brechungsindex | 1.494 |
Flammpunkt | 54.2°C |
Dampfdruck | 1.83mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |