ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207919-09-3 2,3,4-trifluorobenzamide |
|
produktnavn | 2,3,4-trifluorobenzamide |
Engelsk navn | 2,3,4-trifluorobenzamide;Trifluorobenzamide1 |
Molekylær Formel | C7H4F3NO |
Molekylvekt | 175.108 |
InChI | InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
CAS-nummer | 207919-09-3 |
Molecular Structure | ![]() |
Tetthet | 1.45g/cm3 |
Smeltepunkt | 127-129℃ |
Kokepunkt | 166°C at 760 mmHg |
Brytningsindeks | 1.494 |
Flammepunktet | 54.2°C |
Damptrykk | 1.83mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |