ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207919-09-3 2,3,4-trifluorobenzamide |
|
Nazwa produktu: | 2,3,4-trifluorobenzamide |
Angielska nazwa | 2,3,4-trifluorobenzamide;Trifluorobenzamide1 |
MF | C7H4F3NO |
Masie cząsteczkowej | 175.108 |
InChI | InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
Nr CAS | 207919-09-3 |
Struktury molekularnej | ![]() |
Gęstość | 1.45g/cm3 |
Temperatura topnienia | 127-129℃ |
Temperatura wrzenia | 166°C at 760 mmHg |
Współczynnik załamania | 1.494 |
Temperatura zapłonu | 54.2°C |
Ciśnienie pary | 1.83mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |