ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207919-09-3 2,3,4-trifluorobenzamide |
|
Ürün Adı | 2,3,4-trifluorobenzamide |
ingilizce adı | 2,3,4-trifluorobenzamide;Trifluorobenzamide1 |
Moleküler Formülü | C7H4F3NO |
Molekül Ağırlığı | 175.108 |
InChI | InChI=1/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
CAS kayıt numarası | 207919-09-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.45g/cm3 |
Ergime noktası | 127-129℃ |
Kaynama noktası | 166°C at 760 mmHg |
Kırılma indisi | 1.494 |
Alevlenme noktası | 54.2°C |
Buhar basıncı | 1.83mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |