ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
|
Produkt-Name | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
Englischer Name | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine;N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
Molekulare Formel | C12H17NO2 |
Molecular Weight | 207.2689 |
InChl | InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
CAS Registry Number | 21398-64-1 |
Molecular Structure | ![]() |
Dichte | 1.046g/cm3 |
Siedepunkt | 288.7°C at 760 mmHg |
Brechungsindex | 1.509 |
Flammpunkt | 118.1°C |
Dampfdruck | 0.0023mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |