ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
|
produktnavn | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
Engelsk navn | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine;N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
Molekylær Formel | C12H17NO2 |
Molekylvekt | 207.2689 |
InChI | InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
CAS-nummer | 21398-64-1 |
Molecular Structure | ![]() |
Tetthet | 1.046g/cm3 |
Kokepunkt | 288.7°C at 760 mmHg |
Brytningsindeks | 1.509 |
Flammepunktet | 118.1°C |
Damptrykk | 0.0023mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |