ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
|
Ürün Adı | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
ingilizce adı | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine;N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
Moleküler Formülü | C12H17NO2 |
Molekül Ağırlığı | 207.2689 |
InChI | InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
CAS kayıt numarası | 21398-64-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.046g/cm3 |
Kaynama noktası | 288.7°C at 760 mmHg |
Kırılma indisi | 1.509 |
Alevlenme noktası | 118.1°C |
Buhar basıncı | 0.0023mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |