ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
|
نام محصول | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
نام انگلیسی | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine;N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
میدان مغناطیسی | C12H17NO2 |
وزن مولکولی | 207.2689 |
InChI | InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
شماره سیایاس | 21398-64-1 |
ساختار مولکولی | ![]() |
تراکم | 1.046g/cm3 |
نقطه غلیان | 288.7°C at 760 mmHg |
ضریب شکست | 1.509 |
نقطه اشتعال | 118.1°C |
فشار بخار | 0.0023mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |