ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
249278-33-9 3-[2,3-Di(benzyloxy)phenyl]propanenitril | 
    |
| Produkt-Name | 3-[2,3-Di(benzyloxy)phenyl]propanenitril | 
| Synonyme | 3-[2,3-Bis(benzyloxy)phenyl]propanenitril; | 
| Englischer Name | 3-[2,3-di(benzyloxy)phenyl]propanenitrile;3-[2,3-bis(benzyloxy)phenyl]propanenitrile | 
| Molekulare Formel | C23H21NO2 | 
| Molecular Weight | 343.4183 | 
| InChl | InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 | 
| CAS Registry Number | 249278-33-9 | 
| Molecular Structure | ![]()  | 
    
| Dichte | 1.138g/cm3 | 
| Schmelzpunkt | 200℃ | 
| Siedepunkt | 525.9°C at 760 mmHg | 
| Brechungsindex | 1.596 | 
| Flammpunkt | 174.5°C | 
| Dampfdruck | 3.75E-11mmHg at 25°C | 
| Gefahrensymbole | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
    
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; | 
    
| MSDS | |