ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
249278-33-9 3- [2,3- 디 (벤질 옥시) 페닐] 프로판 니트릴 | 
    |
| 상품명칭 | 3- [2,3- 디 (벤질 옥시) 페닐] 프로판 니트릴 | 
| 별명 | 3- [2,3- 비스 (벤질 옥시) 페닐] 프로판 니트릴; | 
| 영문 이름 | 3-[2,3-di(benzyloxy)phenyl]propanenitrile;3-[2,3-bis(benzyloxy)phenyl]propanenitrile | 
| 분자식 | C23H21NO2 | 
| 분자량 | 343.4183 | 
| InChI | InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 | 
| cas번호 | 249278-33-9 | 
| 분자 구조 | ![]()  | 
    
| 밀도 | 1.138g/cm3 | 
| 녹는 점 | 200℃ | 
| 비등점 | 525.9°C at 760 mmHg | 
| 굴절 지수 | 1.596 | 
| 인화점 | 174.5°C | 
| 증기압 | 3.75E-11mmHg at 25°C | 
| 위험성 표시 | |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
    
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; | 
    
| MSDS | |