ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
249278-33-9 3-[2,3-di(benzyloxy)fenyl]propaannitril | 
    |
| Naam product | 3-[2,3-di(benzyloxy)fenyl]propaannitril | 
| Synoniemen | 3-[2,3-bis(benzyloxy)fenyl]propaannitril; | 
| Engelse naam | 3-[2,3-di(benzyloxy)phenyl]propanenitrile;3-[2,3-bis(benzyloxy)phenyl]propanenitrile | 
| MF | C23H21NO2 | 
| Molecuulgewicht | 343.4183 | 
| InChI | InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 | 
| CAS-nummer | 249278-33-9 | 
| Moleculaire Structuur | ![]()  | 
    
| Dichtheid | 1.138g/cm3 | 
| Smeltpunt | 200℃ | 
| Kookpunt | 525.9°C at 760 mmHg | 
| Brekingsindex | 1.596 | 
| Vlampunt | 174.5°C | 
| Dampdruk | 3.75E-11mmHg at 25°C | 
| Gevaarsymbolen | |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
    
| Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; | 
    
| MSDS | |