ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28804-88-8 Dimethylnaphthalene, mixture of isomers |
|
Produkt-Name | Dimethylnaphthalene, mixture of isomers |
Englischer Name | Dimethylnaphthalene, mixture of isomers;naphthalene, 1,2-dimethyl-;1,2-dimethyl-naphthalene |
Molekulare Formel | C12H12 |
Molecular Weight | 156.2237 |
InChl | InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
CAS Registry Number | 28804-88-8 |
EINECS | 249-241-5 |
Molecular Structure | ![]() |
Dichte | 1g/cm3 |
Siedepunkt | 264.4°C at 760 mmHg |
Brechungsindex | 1.604 |
Flammpunkt | 110.5°C |
Dampfdruck | 0.0159mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |