ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28804-88-8 Dimethylnaphthalene, mixture of isomers |
|
उत्पाद का नाम | Dimethylnaphthalene, mixture of isomers |
अंग्रेज | Dimethylnaphthalene, mixture of isomers;naphthalene, 1,2-dimethyl-;1,2-dimethyl-naphthalene |
आणविक फार्मूला | C12H12 |
आण्विक वजन | 156.2237 |
InChI | InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
कैस रजिस्टी संख्या | 28804-88-8 |
EINECS | 249-241-5 |
आणविक संरचना | ![]() |
घनत्व | 1g/cm3 |
उबलने का समय | 264.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.604 |
फ्लैश प्वाइंट | 110.5°C |
वाष्प का दबाव | 0.0159mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |