ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28804-88-8 Dimethylnaphthalene, mixture of isomers |
|
termék neve | Dimethylnaphthalene, mixture of isomers |
Angol név | Dimethylnaphthalene, mixture of isomers;naphthalene, 1,2-dimethyl-;1,2-dimethyl-naphthalene |
MF | C12H12 |
Molekulatömeg | 156.2237 |
InChI | InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
CAS-szám | 28804-88-8 |
EINECS | 249-241-5 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1g/cm3 |
Forráspont | 264.4°C at 760 mmHg |
Törésmutató | 1.604 |
Gyulladáspont | 110.5°C |
Gőznyomás | 0.0159mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |