ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28804-88-8 Dimethylnaphthalene, mixture of isomers |
|
Nazwa produktu: | Dimethylnaphthalene, mixture of isomers |
Angielska nazwa | Dimethylnaphthalene, mixture of isomers;naphthalene, 1,2-dimethyl-;1,2-dimethyl-naphthalene |
MF | C12H12 |
Masie cząsteczkowej | 156.2237 |
InChI | InChI=1/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
Nr CAS | 28804-88-8 |
EINECS | 249-241-5 |
Struktury molekularnej | ![]() |
Gęstość | 1g/cm3 |
Temperatura wrzenia | 264.4°C at 760 mmHg |
Współczynnik załamania | 1.604 |
Temperatura zapłonu | 110.5°C |
Ciśnienie pary | 0.0159mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |