ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-02-6 Triphenylcarbenium tetrafluoroborate |
|
| Produkt-Name | Triphenylcarbenium tetrafluoroborate |
| Englischer Name | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate |
| Molekulare Formel | C19H15BF4 |
| Molecular Weight | 330.127 |
| InChl | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| CAS Registry Number | 341-02-6 |
| EINECS | 206-433-3 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 205-215℃ |
| Gefahrensymbole | |
| Risk Codes | R34##Causes burns.:; |
| Safety Beschreibung | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |