ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-02-6 Triphenylcarbenium tetrafluoroborate |
|
| उत्पाद का नाम | Triphenylcarbenium tetrafluoroborate |
| अंग्रेज | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate |
| आणविक फार्मूला | C19H15BF4 |
| आण्विक वजन | 330.127 |
| InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| कैस रजिस्टी संख्या | 341-02-6 |
| EINECS | 206-433-3 |
| आणविक संरचना | ![]() |
| गलनांक | 205-215℃ |
| खतरा प्रतीक | |
| खतरे के कोड | R34##Causes burns.:; |
| सुरक्षा विवरण | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |