ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-02-6 Triphenylcarbenium tetrafluoroborate |
|
| Nome do produto | Triphenylcarbenium tetrafluoroborate |
| Nome em inglês | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate |
| Fórmula molecular | C19H15BF4 |
| Peso Molecular | 330.127 |
| InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| CAS Registry Number | 341-02-6 |
| EINECS | 206-433-3 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 205-215℃ |
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; |
| Descrição da Segurança | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |