ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-02-6 Triphenylcarbenium tetrafluoroborate | 
    |
| Ονομασία του προϊόντος | Triphenylcarbenium tetrafluoroborate | 
| Αγγλικό όνομα | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate | 
| MF | C19H15BF4 | 
| Μοριακό βάρος | 330.127 | 
| InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 | 
| CAS ΟΧΙ | 341-02-6 | 
| EINECS | 206-433-3 | 
| Μοριακή δομή | ![]()  | 
    
| Σημείο τήξης | 205-215℃ | 
| Σύμβολα επικινδυνότητας | |
| Κινδύνου Κώδικες | R34##Causes burns.:; | 
    
| Περιγραφή της ασφάλειας | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |