ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | |
| Produkt-Name | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | 
| Englischer Name | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; | 
| Molekulare Formel | C10H7ClN4 | 
| Molecular Weight | 218.6424 | 
| InChl | InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 | 
| CAS Registry Number | 51516-67-7 | 
| Molecular Structure |  | 
| Dichte | 1.41g/cm3 | 
| Schmelzpunkt | 170℃ | 
| Siedepunkt | 424.2°C at 760 mmHg | 
| Brechungsindex | 1.686 | 
| Flammpunkt | 210.4°C | 
| Dampfdruck | 2.1E-07mmHg at 25°C | 
| Gefahrensymbole | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
| Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; | 
| MSDS | |