ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | |
| Nazwa produktu: | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | 
| Angielska nazwa | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; | 
| MF | C10H7ClN4 | 
| Masie cząsteczkowej | 218.6424 | 
| InChI | InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 | 
| Nr CAS | 51516-67-7 | 
| Struktury molekularnej |  | 
| Gęstość | 1.41g/cm3 | 
| Temperatura topnienia | 170℃ | 
| Temperatura wrzenia | 424.2°C at 760 mmHg | 
| Współczynnik załamania | 1.686 | 
| Temperatura zapłonu | 210.4°C | 
| Ciśnienie pary | 2.1E-07mmHg at 25°C | 
| Symbole zagrożenia | |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
| Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.:; | 
| MSDS | |