ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | |
| Nome do produto | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | 
| Nome em inglês | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; | 
| Fórmula molecular | C10H7ClN4 | 
| Peso Molecular | 218.6424 | 
| InChI | InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 | 
| CAS Registry Number | 51516-67-7 | 
| Estrutura Molecular |  | 
| Densidade | 1.41g/cm3 | 
| Ponto de fusão | 170℃ | 
| Ponto de ebulição | 424.2°C at 760 mmHg | 
| índice de refração | 1.686 | 
| O ponto de inflamação | 210.4°C | 
| Pressão de vapor | 2.1E-07mmHg at 25°C | 
| Símbolos de perigo | |
| Códigos de risco | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
| Descrição da Segurança | S36/37##Wear suitable protective clothing and gloves.:; | 
| MSDS | |