ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | |
| Naam product | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile | 
| Engelse naam | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; | 
| MF | C10H7ClN4 | 
| Molecuulgewicht | 218.6424 | 
| InChI | InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 | 
| CAS-nummer | 51516-67-7 | 
| Moleculaire Structuur |  | 
| Dichtheid | 1.41g/cm3 | 
| Smeltpunt | 170℃ | 
| Kookpunt | 424.2°C at 760 mmHg | 
| Brekingsindex | 1.686 | 
| Vlampunt | 210.4°C | 
| Dampdruk | 2.1E-07mmHg at 25°C | 
| Gevaarsymbolen | |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
| Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; | 
| MSDS | |