ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52516-20-8 2-(3-chlorophenyl)-N-methylethanamine |
|
| Produkt-Name | 2-(3-chlorophenyl)-N-methylethanamine |
| Englischer Name | 2-(3-chlorophenyl)-N-methylethanamine;2-(3-Chlorophenyl)-N-methylethanamine;Benzeneethanamine, 3-chloro-N-methyl-;3-Chloro-N-methyl-benzeneethanamine |
| Molekulare Formel | C9H12ClN |
| Molecular Weight | 169.6513 |
| InChl | InChI=1/C9H12ClN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7,11H,5-6H2,1H3 |
| CAS Registry Number | 52516-20-8 |
| Molecular Structure | ![]() |
| Dichte | 1.063g/cm3 |
| Siedepunkt | 236.967°C at 760 mmHg |
| Brechungsindex | 1.525 |
| Flammpunkt | 97.114°C |
| Dampfdruck | 0.046mmHg at 25°C |
| MSDS | |