ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52516-20-8 2-(3-chlorophenyl)-N-methylethanamine |
|
| produktnavn | 2-(3-chlorophenyl)-N-methylethanamine |
| Engelsk navn | 2-(3-chlorophenyl)-N-methylethanamine;2-(3-Chlorophenyl)-N-methylethanamine;Benzeneethanamine, 3-chloro-N-methyl-;3-Chloro-N-methyl-benzeneethanamine |
| Molekylær Formel | C9H12ClN |
| Molekylvekt | 169.6513 |
| InChI | InChI=1/C9H12ClN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7,11H,5-6H2,1H3 |
| CAS-nummer | 52516-20-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.063g/cm3 |
| Kokepunkt | 236.967°C at 760 mmHg |
| Brytningsindeks | 1.525 |
| Flammepunktet | 97.114°C |
| Damptrykk | 0.046mmHg at 25°C |
| MSDS | |