ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52516-20-8 2-(3-chlorophenyl)-N-methylethanamine |
|
| Nom | 2-(3-chlorophenyl)-N-methylethanamine |
| Nom anglais | 2-(3-chlorophenyl)-N-methylethanamine;2-(3-Chlorophenyl)-N-methylethanamine;Benzeneethanamine, 3-chloro-N-methyl-;3-Chloro-N-methyl-benzeneethanamine |
| Formule moléculaire | C9H12ClN |
| Poids Moléculaire | 169.6513 |
| InChl | InChI=1/C9H12ClN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7,11H,5-6H2,1H3 |
| Numéro de registre CAS | 52516-20-8 |
| Structure moléculaire | ![]() |
| Densité | 1.063g/cm3 |
| Point d'ébullition | 236.967°C at 760 mmHg |
| Indice de réfraction | 1.525 |
| Point d'éclair | 97.114°C |
| Pression de vapeur | 0.046mmHg at 25°C |
| MSDS | |