ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52516-20-8 2-(3-chlorophenyl)-N-methylethanamine |
|
| Nome do produto | 2-(3-chlorophenyl)-N-methylethanamine |
| Nome em inglês | 2-(3-chlorophenyl)-N-methylethanamine;2-(3-Chlorophenyl)-N-methylethanamine;Benzeneethanamine, 3-chloro-N-methyl-;3-Chloro-N-methyl-benzeneethanamine |
| Fórmula molecular | C9H12ClN |
| Peso Molecular | 169.6513 |
| InChI | InChI=1/C9H12ClN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7,11H,5-6H2,1H3 |
| CAS Registry Number | 52516-20-8 |
| Estrutura Molecular | ![]() |
| Densidade | 1.063g/cm3 |
| Ponto de ebulição | 236.967°C at 760 mmHg |
| índice de refração | 1.525 |
| O ponto de inflamação | 97.114°C |
| Pressão de vapor | 0.046mmHg at 25°C |
| MSDS | |