ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52829-98-8 1-Cyclopentylethanol |
|
Produkt-Name | 1-Cyclopentylethanol |
Englischer Name | 1-Cyclopentylethanol;Cyclopentyl methyl carbinol |
Molekulare Formel | C7H14O |
Molecular Weight | 114.1855 |
InChl | InChI=1/C7H14O/c1-6(8)7-4-2-3-5-7/h6-8H,2-5H2,1H3 |
CAS Registry Number | 52829-98-8 |
EINECS | 258-208-4 |
Molecular Structure | ![]() |
Dichte | 0.937g/cm3 |
Siedepunkt | 175.8°C at 760 mmHg |
Brechungsindex | 1.467 |
Flammpunkt | 71.4°C |
Dampfdruck | 0.345mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |