ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52829-98-8 1-Cyclopentylethanol |
|
produktnavn | 1-Cyclopentylethanol |
Engelsk navn | 1-Cyclopentylethanol;Cyclopentyl methyl carbinol |
Molekylær Formel | C7H14O |
Molekylvekt | 114.1855 |
InChI | InChI=1/C7H14O/c1-6(8)7-4-2-3-5-7/h6-8H,2-5H2,1H3 |
CAS-nummer | 52829-98-8 |
EINECS | 258-208-4 |
Molecular Structure | ![]() |
Tetthet | 0.937g/cm3 |
Kokepunkt | 175.8°C at 760 mmHg |
Brytningsindeks | 1.467 |
Flammepunktet | 71.4°C |
Damptrykk | 0.345mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |