ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52829-98-8 1-Cyclopentylethanol |
|
Ürün Adı | 1-Cyclopentylethanol |
ingilizce adı | 1-Cyclopentylethanol;Cyclopentyl methyl carbinol |
Moleküler Formülü | C7H14O |
Molekül Ağırlığı | 114.1855 |
InChI | InChI=1/C7H14O/c1-6(8)7-4-2-3-5-7/h6-8H,2-5H2,1H3 |
CAS kayıt numarası | 52829-98-8 |
EINECS | 258-208-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.937g/cm3 |
Kaynama noktası | 175.8°C at 760 mmHg |
Kırılma indisi | 1.467 |
Alevlenme noktası | 71.4°C |
Buhar basıncı | 0.345mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |