ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52829-98-8 1-Cyclopentylethanol |
|
Naam product | 1-Cyclopentylethanol |
Engelse naam | 1-Cyclopentylethanol;Cyclopentyl methyl carbinol |
MF | C7H14O |
Molecuulgewicht | 114.1855 |
InChI | InChI=1/C7H14O/c1-6(8)7-4-2-3-5-7/h6-8H,2-5H2,1H3 |
CAS-nummer | 52829-98-8 |
EINECS | 258-208-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.937g/cm3 |
Kookpunt | 175.8°C at 760 mmHg |
Brekingsindex | 1.467 |
Vlampunt | 71.4°C |
Dampdruk | 0.345mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |