ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54551-83-6 Methyl 2,6-dichlorophenylacetate |
|
Produkt-Name | Methyl 2,6-dichlorophenylacetate |
Englischer Name | Methyl 2,6-dichlorophenylacetate;2,6-Dichlorophenylacetic acid methyl ester |
Molekulare Formel | C9H8Cl2O2 |
Molecular Weight | 219.0646 |
InChl | InChI=1/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
CAS Registry Number | 54551-83-6 |
EINECS | 259-221-8 |
Molecular Structure | ![]() |
Dichte | 1.318g/cm3 |
Siedepunkt | 272.3°C at 760 mmHg |
Brechungsindex | 1.538 |
Flammpunkt | 111.5°C |
Dampfdruck | 0.00613mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |