ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54551-83-6 Methyl 2,6-dichlorophenylacetate |
|
상품명칭 | Methyl 2,6-dichlorophenylacetate |
영문 이름 | Methyl 2,6-dichlorophenylacetate;2,6-Dichlorophenylacetic acid methyl ester |
분자식 | C9H8Cl2O2 |
분자량 | 219.0646 |
InChI | InChI=1/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
cas번호 | 54551-83-6 |
EC번호 | 259-221-8 |
분자 구조 | ![]() |
밀도 | 1.318g/cm3 |
비등점 | 272.3°C at 760 mmHg |
굴절 지수 | 1.538 |
인화점 | 111.5°C |
증기압 | 0.00613mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |