ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54551-83-6 Methyl 2,6-dichlorophenylacetate |
|
Nama produk | Methyl 2,6-dichlorophenylacetate |
Nama bahasa Inggris | Methyl 2,6-dichlorophenylacetate;2,6-Dichlorophenylacetic acid methyl ester |
MF | C9H8Cl2O2 |
Berat Molekul | 219.0646 |
InChI | InChI=1/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
CAS NO | 54551-83-6 |
EINECS | 259-221-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.318g/cm3 |
Titik didih | 272.3°C at 760 mmHg |
Indeks bias | 1.538 |
Titik nyala | 111.5°C |
Tekanan uap | 0.00613mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |