ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54551-83-6 Methyl 2,6-dichlorophenylacetate |
|
نام محصول | Methyl 2,6-dichlorophenylacetate |
نام انگلیسی | Methyl 2,6-dichlorophenylacetate;2,6-Dichlorophenylacetic acid methyl ester |
میدان مغناطیسی | C9H8Cl2O2 |
وزن مولکولی | 219.0646 |
InChI | InChI=1/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
شماره سیایاس | 54551-83-6 |
تعداد کمیسیون اروپایی | 259-221-8 |
ساختار مولکولی | ![]() |
تراکم | 1.318g/cm3 |
نقطه غلیان | 272.3°C at 760 mmHg |
ضریب شکست | 1.538 |
نقطه اشتعال | 111.5°C |
فشار بخار | 0.00613mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |