ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59373-32-9 Methyl-2,2-dimethyl-4,6-dioxocyclohexancarboxylat |
|
Produkt-Name | Methyl-2,2-dimethyl-4,6-dioxocyclohexancarboxylat |
Synonyme | Methyl-2,2-dimethyl-4,6-dioxocyclohexancarboxylat |
Englischer Name | methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate;Methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
Molekulare Formel | C10H14O4 |
Molecular Weight | 198.2158 |
InChl | InChI=1/C10H14O4/c1-10(2)5-6(11)4-7(12)8(10)9(13)14-3/h8H,4-5H2,1-3H3 |
CAS Registry Number | 59373-32-9 |
EINECS | 261-720-0 |
Molecular Structure | ![]() |
Dichte | 1.129g/cm3 |
Schmelzpunkt | 94℃ |
Siedepunkt | 300.3°C at 760 mmHg |
Brechungsindex | 1.461 |
Flammpunkt | 130.5°C |
Dampfdruck | 0.00113mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |