ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59373-32-9 metil 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
|
Nama produk | metil 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
Sinonim | Metil 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
Nama Inggeris | methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate;Methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
MF | C10H14O4 |
Berat Molekul | 198.2158 |
InChI | InChI=1/C10H14O4/c1-10(2)5-6(11)4-7(12)8(10)9(13)14-3/h8H,4-5H2,1-3H3 |
CAS NO | 59373-32-9 |
EINECS | 261-720-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.129g/cm3 |
Titik lebur | 94℃ |
Titik didih | 300.3°C at 760 mmHg |
Indeks bias | 1.461 |
Titik nyala | 130.5°C |
Tekanan wap | 0.00113mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |