ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59373-32-9 metyl 2,2-dimetyl-4,6-dioksocykloheksanekarboksylat |
|
produktnavn | metyl 2,2-dimetyl-4,6-dioksocykloheksanekarboksylat |
Synonymer | Metyl 2,2-dimetyl-4,6-dioksocykloheksanekarboksylat |
Engelsk navn | methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate;Methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
Molekylær Formel | C10H14O4 |
Molekylvekt | 198.2158 |
InChI | InChI=1/C10H14O4/c1-10(2)5-6(11)4-7(12)8(10)9(13)14-3/h8H,4-5H2,1-3H3 |
CAS-nummer | 59373-32-9 |
EINECS | 261-720-0 |
Molecular Structure | ![]() |
Tetthet | 1.129g/cm3 |
Smeltepunkt | 94℃ |
Kokepunkt | 300.3°C at 760 mmHg |
Brytningsindeks | 1.461 |
Flammepunktet | 130.5°C |
Damptrykk | 0.00113mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |