ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59373-32-9 메틸 2,2- 디메틸 -4,6- 디옥소 시클로 헥산 카르 복실 레이트 |
|
상품명칭 | 메틸 2,2- 디메틸 -4,6- 디옥소 시클로 헥산 카르 복실 레이트 |
별명 | 메틸 2,2-디메틸-4,6-디옥소사이클로헥산카르복실레이트 |
영문 이름 | methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate;Methyl 2,2-dimethyl-4,6-dioxocyclohexanecarboxylate |
분자식 | C10H14O4 |
분자량 | 198.2158 |
InChI | InChI=1/C10H14O4/c1-10(2)5-6(11)4-7(12)8(10)9(13)14-3/h8H,4-5H2,1-3H3 |
cas번호 | 59373-32-9 |
EC번호 | 261-720-0 |
분자 구조 | ![]() |
밀도 | 1.129g/cm3 |
녹는 점 | 94℃ |
비등점 | 300.3°C at 760 mmHg |
굴절 지수 | 1.461 |
인화점 | 130.5°C |
증기압 | 0.00113mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |