ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54243-74-2 5-oxo-L-proline, composé avec du 2-aminoéthanol (1 :1) |
|
| Nom | 5-oxo-L-proline, composé avec du 2-aminoéthanol (1 :1) |
| Synonymes | 5-Oxo-L-proline, composé de 2-aminoéthanol (1 :1) ; 5-oxo-L-proline - 2-aminoéthanol (1 :1) ; |
| Nom anglais | 5-oxo-L-proline, compound with 2-aminoethanol (1:1);5-Oxo-L-proline, compound with 2-aminoethanol (1:1);5-oxo-L-proline - 2-aminoethanol (1:1) |
| Formule moléculaire | C7H14N2O4 |
| Poids Moléculaire | 190.1971 |
| InChl | InChI=1/C5H7NO3.C2H7NO/c7-4-2-1-3(6-4)5(8)9;3-1-2-4/h3H,1-2H2,(H,6,7)(H,8,9);4H,1-3H2/t3-;/m0./s1 |
| Numéro de registre CAS | 54243-74-2 |
| EINECS | 259-042-5 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 453.1°C at 760 mmHg |
| Point d'éclair | 227.8°C |
| Pression de vapeur | 1.79E-09mmHg at 25°C |
| MSDS | |