ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54243-74-2 5-okso-L-prolin, 2-aminoetanol (1:1) içeren bileşik |
|
| Ürün Adı | 5-okso-L-prolin, 2-aminoetanol (1:1) içeren bileşik |
| Eş anlamlı | 5-Okso-L-prolin, 2-aminoetanol (1:1) içeren bileşik; 5-okso-L-prolin - 2-aminoetanol (1:1); |
| ingilizce adı | 5-oxo-L-proline, compound with 2-aminoethanol (1:1);5-Oxo-L-proline, compound with 2-aminoethanol (1:1);5-oxo-L-proline - 2-aminoethanol (1:1) |
| Moleküler Formülü | C7H14N2O4 |
| Molekül Ağırlığı | 190.1971 |
| InChI | InChI=1/C5H7NO3.C2H7NO/c7-4-2-1-3(6-4)5(8)9;3-1-2-4/h3H,1-2H2,(H,6,7)(H,8,9);4H,1-3H2/t3-;/m0./s1 |
| CAS kayıt numarası | 54243-74-2 |
| EINECS | 259-042-5 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 453.1°C at 760 mmHg |
| Alevlenme noktası | 227.8°C |
| Buhar basıncı | 1.79E-09mmHg at 25°C |
| MSDS | |