ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54243-74-2 5-옥소-L-프롤린, 2-아미노에탄올과 화합물(1:1) |
|
| 상품명칭 | 5-옥소-L-프롤린, 2-아미노에탄올과 화합물(1:1) |
| 별명 | 5-옥소-L-프롤린, 2-아미노에탄올(1:1)과 화합물; 5-옥소-L-프롤린 - 2-아미노에탄올 (1:1); |
| 영문 이름 | 5-oxo-L-proline, compound with 2-aminoethanol (1:1);5-Oxo-L-proline, compound with 2-aminoethanol (1:1);5-oxo-L-proline - 2-aminoethanol (1:1) |
| 분자식 | C7H14N2O4 |
| 분자량 | 190.1971 |
| InChI | InChI=1/C5H7NO3.C2H7NO/c7-4-2-1-3(6-4)5(8)9;3-1-2-4/h3H,1-2H2,(H,6,7)(H,8,9);4H,1-3H2/t3-;/m0./s1 |
| cas번호 | 54243-74-2 |
| EC번호 | 259-042-5 |
| 분자 구조 | ![]() |
| 비등점 | 453.1°C at 760 mmHg |
| 인화점 | 227.8°C |
| 증기압 | 1.79E-09mmHg at 25°C |
| MSDS | |