ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54243-74-2 5-okso-L-prolin, senyawa dengan 2-aminoetanol (1:1) |
|
| Nama produk | 5-okso-L-prolin, senyawa dengan 2-aminoetanol (1:1) |
| Sinonim | 5-Oxo-L-prolin, senyawa dengan 2-aminoetanol (1: 1); 5-okso-L-prolin - 2-aminoetanol (1: 1); |
| Nama bahasa Inggris | 5-oxo-L-proline, compound with 2-aminoethanol (1:1);5-Oxo-L-proline, compound with 2-aminoethanol (1:1);5-oxo-L-proline - 2-aminoethanol (1:1) |
| MF | C7H14N2O4 |
| Berat Molekul | 190.1971 |
| InChI | InChI=1/C5H7NO3.C2H7NO/c7-4-2-1-3(6-4)5(8)9;3-1-2-4/h3H,1-2H2,(H,6,7)(H,8,9);4H,1-3H2/t3-;/m0./s1 |
| CAS NO | 54243-74-2 |
| EINECS | 259-042-5 |
| Struktur Molekul | ![]() |
| Titik didih | 453.1°C at 760 mmHg |
| Titik nyala | 227.8°C |
| Tekanan uap | 1.79E-09mmHg at 25°C |
| MSDS | |