ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39905-44-7 p-Heptyloxyaniline |
|
Ονομασία του προϊόντος | p-Heptyloxyaniline |
Αγγλικό όνομα | p-Heptyloxyaniline;4-n-Heptyloxyaniline;4-(heptyloxy)aniline |
MF | C13H21NO |
Μοριακό βάρος | 207.3119 |
InChI | InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
CAS ΟΧΙ | 39905-44-7 |
Μοριακή δομή | ![]() |
Πυκνότητα | 0.965g/cm3 |
Σημείο βρασμού | 325.9°C at 760 mmHg |
Δείκτης διάθλασης | 1.516 |
Σημείο ανάφλεξης | 145°C |
Πίεση ατμών | 0.000223mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |